C9H14F3NO3 — CID 12506159
methyl 2-(diethylcarbamoyl)-3,3,3-trifluoropropanoate (PubChem CID 12506159) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is methyl 2-(diethylcarbamoyl)-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-(diethylcarbamoyl)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 12506159 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | methyl 2-(diethylcarbamoyl)-3,3,3-trifluoropropanoate |
| SMILES | CCN(CC)C(=O)C(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO3/c1-4-13(5-2)7(14)6(8(15)16-3)9(10,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | LPSWSZDVTITDFF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|