C12H18Li2O — CID 12506200
dilithium;3-methoxypenta-1,4-dien-3-ylcyclohexane (PubChem CID 12506200) has the molecular formula C12H18Li2O and a molecular weight of 192.16 g/mol. Its IUPAC name is dilithium;3-methoxypenta-1,4-dien-3-ylcyclohexane.
| Compound Name | dilithium;3-methoxypenta-1,4-dien-3-ylcyclohexane |
|---|---|
| PubChem CID | 12506200 |
| Molecular Formula | C12H18Li2O |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | dilithium;3-methoxypenta-1,4-dien-3-ylcyclohexane |
| SMILES | [H]/[C-]=C\C(/C=[C-]\[H])(OC)C1CCCCC1.[Li+].[Li+] |
| InChI | InChI=1S/C12H18O.2Li/c1-4-12(5-2,13-3)11-9-7-6-8-10-11;;/h1-2,4-5,11H,6-10H2,3H3;;/q-2;2*+1 |
| InChIKey | SYINMRLPWFACHY-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|