C20H36OSn — CID 12506193
1,1-dibutyl-4-cyclohexyl-4-methoxystannine (PubChem CID 12506193) has the molecular formula C20H36OSn and a molecular weight of 411.22 g/mol. Its IUPAC name is 1,1-dibutyl-4-cyclohexyl-4-methoxystannine.
| Compound Name | 1,1-dibutyl-4-cyclohexyl-4-methoxystannine |
|---|---|
| PubChem CID | 12506193 |
| Molecular Formula | C20H36OSn |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1,1-dibutyl-4-cyclohexyl-4-methoxystannine |
| SMILES | CCCC[Sn]1(CCCC)C=CC(OC)(C2CCCCC2)C=C1 |
| InChI | InChI=1S/C12H18O.2C4H9.Sn/c1-4-12(5-2,13-3)11-9-7-6-8-10-11;2*1-3-4-2;/h1-2,4-5,11H,6-10H2,3H3;2*1,3-4H2,2H3; |
| InChIKey | RPFWVAWUTVZRLR-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |