C18H27ClN2O3S — CID 125064270
(2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(cyclohexylmethyl)propanamide (PubChem CID 125064270) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(cyclohexylmethyl)propanamide.
| Compound Name | (2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(cyclohexylmethyl)propanamide |
|---|---|
| PubChem CID | 125064270 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(cyclohexylmethyl)propanamide |
| SMILES | Cc1ccc(Cl)cc1N([C@H](C)C(=O)NCC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H27ClN2O3S/c1-13-9-10-16(19)11-17(13)21(25(3,23)24)14(2)18(22)20-12-15-7-5-4-6-8-15/h9-11,14-15H,4-8,12H2,1-3H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | BMRSJAHCZNCLFP-CQSZACIVSA-N |
| XLogP | 3.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |