C17H26ClN3O4S — CID 92764440
(2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 92764440) has the molecular formula C17H26ClN3O4S and a molecular weight of 403.93 g/mol. Its IUPAC name is (2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | (2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 92764440 |
| Molecular Formula | C17H26ClN3O4S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (2R)-2-(5-chloro-2-methyl-N-methylsulfonylanilino)-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | Cc1ccc(Cl)cc1N([C@H](C)C(=O)NCCN1CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C17H26ClN3O4S/c1-13-4-5-15(18)12-16(13)21(26(3,23)24)14(2)17(22)19-6-7-20-8-10-25-11-9-20/h4-5,12,14H,6-11H2,1-3H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | UNOHOINNSRVBQT-CQSZACIVSA-N |
| XLogP | 1.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |