C30H34Cl2N4O7S — CID 125075264
(2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide (PubChem CID 125075264) has the molecular formula C30H34Cl2N4O7S and a molecular weight of 665.60 g/mol. Its IUPAC name is (2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 125075264 |
| Molecular Formula | C30H34Cl2N4O7S |
| Molecular Weight | 665.60 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | (2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccc(Cl)cc1Cl)[C@H](Cc1ccccc1)C(=O)NCC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C30H34Cl2N4O7S/c1-20(2)17-33-30(38)27(14-21-8-6-5-7-9-21)34(18-22-10-11-23(31)15-25(22)32)29(37)19-35(44(4,41)42)26-16-24(36(39)40)12-13-28(26)43-3/h5-13,15-16,20,27H,14,17-19H2,1-4H3,(H,33,38)/t27-/m1/s1 |
| InChIKey | BDIPBEQXBOOJRL-HHHXNRCGSA-N |
| XLogP | 5.09 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|