C29H32Cl2N4O6S — CID 125067612
(2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide (PubChem CID 125067612) has the molecular formula C29H32Cl2N4O6S and a molecular weight of 635.57 g/mol. Its IUPAC name is (2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide.
| Compound Name | (2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 125067612 |
| Molecular Formula | C29H32Cl2N4O6S |
| Molecular Weight | 635.57 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | (2R)-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenyl-N-propan-2-ylpropanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccc(Cl)cc1Cl)[C@H](Cc1ccccc1)C(=O)NC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C29H32Cl2N4O6S/c1-19(2)32-29(37)27(14-21-8-6-5-7-9-21)33(17-22-11-12-23(30)15-25(22)31)28(36)18-34(42(4,40)41)26-16-24(35(38)39)13-10-20(26)3/h5-13,15-16,19,27H,14,17-18H2,1-4H3,(H,32,37)/t27-/m1/s1 |
| InChIKey | JOZMTRLUSVDFDW-HHHXNRCGSA-N |
| XLogP | 5.14 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|