C31H34Cl2N4O6S — CID 100531333
(2S)-N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100531333) has the molecular formula C31H34Cl2N4O6S and a molecular weight of 661.61 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100531333 |
| Molecular Formula | C31H34Cl2N4O6S |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccc(Cl)cc1Cl)[C@@H](Cc1ccccc1)C(=O)NC1CCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C31H34Cl2N4O6S/c1-21-12-15-26(37(40)41)18-28(21)36(44(2,42)43)20-30(38)35(19-23-13-14-24(32)17-27(23)33)29(16-22-8-4-3-5-9-22)31(39)34-25-10-6-7-11-25/h3-5,8-9,12-15,17-18,25,29H,6-7,10-11,16,19-20H2,1-2H3,(H,34,39)/t29-/m0/s1 |
| InChIKey | JBXWDFZEELKVKP-LJAQVGFWSA-N |
| XLogP | 5.67 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|