C32H36Cl2N4O6S — CID 125087410
(2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 125087410) has the molecular formula C32H36Cl2N4O6S and a molecular weight of 675.64 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125087410 |
| Molecular Formula | C32H36Cl2N4O6S |
| Molecular Weight | 675.64 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccc(Cl)c(Cl)c1)[C@H](Cc1ccccc1)C(=O)NC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C32H36Cl2N4O6S/c1-22-13-15-26(38(41)42)19-29(22)37(45(2,43)44)21-31(39)36(20-24-14-16-27(33)28(34)17-24)30(18-23-9-5-3-6-10-23)32(40)35-25-11-7-4-8-12-25/h3,5-6,9-10,13-17,19,25,30H,4,7-8,11-12,18,20-21H2,1-2H3,(H,35,40)/t30-/m1/s1 |
| InChIKey | UVVLQNMNOKKYPZ-SSEXGKCCSA-N |
| XLogP | 6.07 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|