C33H40N4O7S — CID 125090178
(2R)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 125090178) has the molecular formula C33H40N4O7S and a molecular weight of 636.77 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125090178 |
| Molecular Formula | C33H40N4O7S |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | COc1cccc(CN(C(=O)CN(c2cc([N+](=O)[O-])ccc2C)S(C)(=O)=O)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C33H40N4O7S/c1-24-17-18-28(37(40)41)21-30(24)36(45(3,42)43)23-32(38)35(22-26-13-10-16-29(19-26)44-2)31(20-25-11-6-4-7-12-25)33(39)34-27-14-8-5-9-15-27/h4,6-7,10-13,16-19,21,27,31H,5,8-9,14-15,20,22-23H2,1-3H3,(H,34,39)/t31-/m1/s1 |
| InChIKey | YVHWJTFCNYYYDH-WJOKGBTCSA-N |
| XLogP | 4.77 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|