C26H34N4O8S — CID 132629080
N-cyclopentyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide (PubChem CID 132629080) has the molecular formula C26H34N4O8S and a molecular weight of 562.65 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | N-cyclopentyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132629080 |
| Molecular Formula | C26H34N4O8S |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | N-cyclopentyl-2-[[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide |
| SMILES | COc1cccc(CN(C(=O)CN(c2cc([N+](=O)[O-])ccc2OC)S(C)(=O)=O)C(C)C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C26H34N4O8S/c1-18(26(32)27-20-9-5-6-10-20)28(16-19-8-7-11-22(14-19)37-2)25(31)17-29(39(4,35)36)23-15-21(30(33)34)12-13-24(23)38-3/h7-8,11-15,18,20H,5-6,9-10,16-17H2,1-4H3,(H,27,32) |
| InChIKey | SXPJFTOYQJJOSD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|