C27H36N4O6S — CID 125051221
(2R)-N-cyclohexyl-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide (PubChem CID 125051221) has the molecular formula C27H36N4O6S and a molecular weight of 544.67 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 125051221 |
| Molecular Formula | C27H36N4O6S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
| SMILES | Cc1cccc(CN(C(=O)CN(c2cc([N+](=O)[O-])ccc2C)S(C)(=O)=O)[C@H](C)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C27H36N4O6S/c1-19-9-8-10-22(15-19)17-29(21(3)27(33)28-23-11-6-5-7-12-23)26(32)18-30(38(4,36)37)25-16-24(31(34)35)14-13-20(25)2/h8-10,13-16,21,23H,5-7,11-12,17-18H2,1-4H3,(H,28,33)/t21-/m1/s1 |
| InChIKey | CIYRVGTUIHRETC-OAQYLSRUSA-N |
| XLogP | 3.84 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|