C26H33BrN4O6S — CID 133175469
2-[(4-bromophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 133175469) has the molecular formula C26H33BrN4O6S and a molecular weight of 609.54 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 133175469 |
| Molecular Formula | C26H33BrN4O6S |
| Molecular Weight | 609.54 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccc(Br)cc1)C(C)C(=O)NC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C26H33BrN4O6S/c1-18-9-14-23(31(34)35)15-24(18)30(38(3,36)37)17-25(32)29(16-20-10-12-21(27)13-11-20)19(2)26(33)28-22-7-5-4-6-8-22/h9-15,19,22H,4-8,16-17H2,1-3H3,(H,28,33) |
| InChIKey | JXPKPPHYHFYINT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|