C26H33ClN4O7S — CID 133264975
2-[(3-chlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide (PubChem CID 133264975) has the molecular formula C26H33ClN4O7S and a molecular weight of 581.09 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide.
| Compound Name | 2-[(3-chlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 133264975 |
| Molecular Formula | C26H33ClN4O7S |
| Molecular Weight | 581.09 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1cccc(Cl)c1)C(C)C(=O)NC1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C26H33ClN4O7S/c1-18(26(33)28-21-10-5-4-6-11-21)29(16-19-8-7-9-20(27)14-19)25(32)17-30(39(3,36)37)23-15-22(31(34)35)12-13-24(23)38-2/h7-9,12-15,18,21H,4-6,10-11,16-17H2,1-3H3,(H,28,33) |
| InChIKey | TZMPTVBUECBSNQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.09 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|