C27H35ClN4O6S — CID 100553478
(2S)-2-[(2-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylbutanamide (PubChem CID 100553478) has the molecular formula C27H35ClN4O6S and a molecular weight of 579.12 g/mol. Its IUPAC name is (2S)-2-[(2-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[(2-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100553478 |
| Molecular Formula | C27H35ClN4O6S |
| Molecular Weight | 579.12 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | (2S)-2-[(2-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1Cl)C(=O)CN(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C27H35ClN4O6S/c1-4-24(27(34)29-21-11-6-5-7-12-21)30(17-20-10-8-9-13-23(20)28)26(33)18-31(39(3,37)38)25-16-22(32(35)36)15-14-19(25)2/h8-10,13-16,21,24H,4-7,11-12,17-18H2,1-3H3,(H,29,34)/t24-/m0/s1 |
| InChIKey | FKEQYSNZOGOHLZ-DEOSSOPVSA-N |
| XLogP | 4.58 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.12 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|