C27H34Cl2N4O6S — CID 132637940
N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide (PubChem CID 132637940) has the molecular formula C27H34Cl2N4O6S and a molecular weight of 613.56 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide.
| Compound Name | N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132637940 |
| Molecular Formula | C27H34Cl2N4O6S |
| Molecular Weight | 613.56 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | N-cyclohexyl-2-[(2,4-dichlorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]butanamide |
| SMILES | CCC(C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C27H34Cl2N4O6S/c1-4-24(27(35)30-21-8-6-5-7-9-21)31(16-19-11-12-20(28)14-23(19)29)26(34)17-32(40(3,38)39)25-15-22(33(36)37)13-10-18(25)2/h10-15,21,24H,4-9,16-17H2,1-3H3,(H,30,35) |
| InChIKey | YQRFXSPSTBCDLT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|