C31H38N4O6S — CID 125107217
(2S)-N-[(2S)-butan-2-yl]-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 125107217) has the molecular formula C31H38N4O6S and a molecular weight of 594.73 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125107217 |
| Molecular Formula | C31H38N4O6S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]-[(2-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1C)C(=O)CN(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C31H38N4O6S/c1-6-24(4)32-31(37)29(18-25-13-8-7-9-14-25)33(20-26-15-11-10-12-22(26)2)30(36)21-34(42(5,40)41)28-19-27(35(38)39)17-16-23(28)3/h7-17,19,24,29H,6,18,20-21H2,1-5H3,(H,32,37)/t24-,29-/m0/s1 |
| InChIKey | MMQSNBYCBCVARF-OUTSHDOLSA-N |
| XLogP | 4.53 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|