C30H30N2O4 — CID 12508023
N-[(5S)-1,12-dioxo-3-phenyl-2-oxa-4-azatrispiro[4.0.56.2.514.05]nonadec-3-en-13-ylidene]benzamide (PubChem CID 12508023) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is N-[(5S)-1,12-dioxo-3-phenyl-2-oxa-4-azatrispiro[4.0.56.2.514.05]nonadec-3-en-13-ylidene]benzamide.
| Compound Name | N-[(5S)-1,12-dioxo-3-phenyl-2-oxa-4-azatrispiro[4.0.56.2.514.05]nonadec-3-en-13-ylidene]benzamide |
|---|---|
| PubChem CID | 12508023 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[(5S)-1,12-dioxo-3-phenyl-2-oxa-4-azatrispiro[4.0.56.2.514.05]nonadec-3-en-13-ylidene]benzamide |
| SMILES | O=C(/N=C1\C(=O)C2(CCCCC2)[C@@]2(N=C(c3ccccc3)OC2=O)C12CCCCC2)c1ccccc1 |
| InChI | InChI=1S/C30H30N2O4/c33-24-23(31-25(34)21-13-5-1-6-14-21)28(17-9-3-10-18-28)30(29(24)19-11-4-12-20-29)27(35)36-26(32-30)22-15-7-2-8-16-22/h1-2,5-8,13-16H,3-4,9-12,17-20H2/b31-23+/t30-/m0/s1 |
| InChIKey | AHZUHPIPRNAPTQ-JYHMHBGYSA-N |
| XLogP | 5.49 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|