C23H23N3O5S — CID 1250809
3-[(2,3-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-methyl-3-nitrophenyl)benzamide (PubChem CID 1250809) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is 3-[(2,3-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-methyl-3-nitrophenyl)benzamide.
| Compound Name | 3-[(2,3-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-methyl-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 1250809 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 3-[(2,3-dimethylphenyl)sulfamoyl]-4-methyl-N-(2-methyl-3-nitrophenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc([N+](=O)[O-])c2C)cc1S(=O)(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C23H23N3O5S/c1-14-7-5-9-20(16(14)3)25-32(30,31)22-13-18(12-11-15(22)2)23(27)24-19-8-6-10-21(17(19)4)26(28)29/h5-13,25H,1-4H3,(H,24,27) |
| InChIKey | PMEPPZPDVURBHC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|