C16H17N3O5S — CID 26796668
3-(ethylsulfamoyl)-N-(2-methyl-3-nitrophenyl)benzamide (PubChem CID 26796668) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-N-(2-methyl-3-nitrophenyl)benzamide.
| Compound Name | 3-(ethylsulfamoyl)-N-(2-methyl-3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 26796668 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-(ethylsulfamoyl)-N-(2-methyl-3-nitrophenyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)Nc2cccc([N+](=O)[O-])c2C)c1 |
| InChI | InChI=1S/C16H17N3O5S/c1-3-17-25(23,24)13-7-4-6-12(10-13)16(20)18-14-8-5-9-15(11(14)2)19(21)22/h4-10,17H,3H2,1-2H3,(H,18,20) |
| InChIKey | KKBABXNATJKTHZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|