C31H35Cl3N4O7S — CID 125085632
(2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]butanamide (PubChem CID 125085632) has the molecular formula C31H35Cl3N4O7S and a molecular weight of 714.07 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]butanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 125085632 |
| Molecular Formula | C31H35Cl3N4O7S |
| Molecular Weight | 714.07 g/mol |
| Exact Mass | 712.13 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]butanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H35Cl3N4O7S/c1-6-20(4)35-31(40)26(7-2)36(17-21-9-12-24(33)25(34)14-21)30(39)18-37(28-15-22(32)10-13-29(28)45-5)46(43,44)23-11-8-19(3)27(16-23)38(41)42/h8-16,20,26H,6-7,17-18H2,1-5H3,(H,35,40)/t20-,26-/m0/s1 |
| InChIKey | IUWOBWLUDPSBJH-FNZWTVRRSA-N |
| XLogP | 6.79 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.07 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|