C25H18INO3 — CID 1251001
(15R,19S)-1-(hydroxymethyl)-17-(4-iodophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 1251001) has the molecular formula C25H18INO3 and a molecular weight of 507.33 g/mol. Its IUPAC name is (15R,19S)-1-(hydroxymethyl)-17-(4-iodophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-1-(hydroxymethyl)-17-(4-iodophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 1251001 |
| Molecular Formula | C25H18INO3 |
| Molecular Weight | 507.33 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | (15R,19S)-1-(hydroxymethyl)-17-(4-iodophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(I)cc1)C1c3ccccc3C2(CO)c2ccccc21 |
| InChI | InChI=1S/C25H18INO3/c26-14-9-11-15(12-10-14)27-23(29)21-20-16-5-1-3-7-18(16)25(13-28,22(21)24(27)30)19-8-4-2-6-17(19)20/h1-12,20-22,28H,13H2/t20?,21-,22-,25?/m0/s1 |
| InChIKey | CNBICHFMGARDMR-NFJKTXFASA-N |
| XLogP | 3.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|