C24H31FN4O6S — CID 125108710
(2S)-N-[(2S)-butan-2-yl]-2-[(2-fluorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]propanamide (PubChem CID 125108710) has the molecular formula C24H31FN4O6S and a molecular weight of 522.60 g/mol. Its IUPAC name is (2S)-N-[(2S)-butan-2-yl]-2-[(2-fluorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2-fluorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 125108710 |
| Molecular Formula | C24H31FN4O6S |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (2S)-N-[(2S)-butan-2-yl]-2-[(2-fluorophenyl)methyl-[2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetyl]amino]propanamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](C)N(Cc1ccccc1F)C(=O)CN(c1cc([N+](=O)[O-])ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C24H31FN4O6S/c1-6-17(3)26-24(31)18(4)27(14-19-9-7-8-10-21(19)25)23(30)15-28(36(5,34)35)22-13-20(29(32)33)12-11-16(22)2/h7-13,17-18H,6,14-15H2,1-5H3,(H,26,31)/t17-,18-/m0/s1 |
| InChIKey | PQPPTLMAAAAKDM-ROUUACIJSA-N |
| XLogP | 3.14 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|