C5H9N — CID 12510993
N,2-dimethylprop-2-en-1-imine (PubChem CID 12510993) has the molecular formula C5H9N and a molecular weight of 83.13 g/mol. Its IUPAC name is N,2-dimethylprop-2-en-1-imine.
| Compound Name | N,2-dimethylprop-2-en-1-imine |
|---|---|
| PubChem CID | 12510993 |
| Molecular Formula | C5H9N |
| Molecular Weight | 83.13 g/mol |
| Exact Mass | 83.07 |
| IUPAC Name | N,2-dimethylprop-2-en-1-imine |
| SMILES | C=C(C)/C=N/C |
| InChI | InChI=1S/C5H9N/c1-5(2)4-6-3/h4H,1H2,2-3H3/b6-4+ |
| InChIKey | DGAZLOSNDROLQS-GQCTYLIASA-N |
| XLogP | 1.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 83.13 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|