C29H40O4 — CID 125113340
methyl (4S)-4-[(3R,5R,8R,9S,10S,13S,14R,17S)-12-oxo-3-phenoxy-1,2,3,4,5,6,7,8,9,10,11,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 125113340) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is methyl (4S)-4-[(3R,5R,8R,9S,10S,13S,14R,17S)-12-oxo-3-phenoxy-1,2,3,4,5,6,7,8,9,10,11,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(3R,5R,8R,9S,10S,13S,14R,17S)-12-oxo-3-phenoxy-1,2,3,4,5,6,7,8,9,10,11,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 125113340 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | methyl (4S)-4-[(3R,5R,8R,9S,10S,13S,14R,17S)-12-oxo-3-phenoxy-1,2,3,4,5,6,7,8,9,10,11,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@@H]1CC[C@@H]2[C@@H]3CC[C@@H]4C[C@H](Oc5ccccc5)CC[C@@H]4[C@@H]3CC(=O)[C@H]21 |
| InChI | InChI=1S/C29H40O4/c1-18(8-15-28(31)32-2)22-13-14-25-24-11-9-19-16-21(33-20-6-4-3-5-7-20)10-12-23(19)26(24)17-27(30)29(22)25/h3-7,18-19,21-26,29H,8-17H2,1-2H3/t18-,19+,21+,22-,23-,24-,25+,26-,29-/m0/s1 |
| InChIKey | MWOKEIBFVFMCKD-JOUFWUORSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |