C27H42O6 — CID 57362749
methyl 4-[(8R,9R,10S,13R,14S)-3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 57362749) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is methyl 4-[(8R,9R,10S,13R,14S)-3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(8R,9R,10S,13R,14S)-3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 57362749 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | methyl 4-[(8R,9R,10S,13R,14S)-3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)C1CC[C@@H]2[C@@H]1C(OC(C)=O)C[C@H]1[C@H]2CCC2CC(OC(C)=O)CC[C@@H]21 |
| InChI | InChI=1S/C27H42O6/c1-15(5-12-26(30)31-4)20-10-11-23-22-8-6-18-13-19(32-16(2)28)7-9-21(18)24(22)14-25(27(20)23)33-17(3)29/h15,18-25,27H,5-14H2,1-4H3/t15?,18?,19?,20?,21-,22-,23-,24+,25?,27+/m0/s1 |
| InChIKey | DVCAHONLOKBPBC-GUGBLUBFSA-N |
| XLogP | 4.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|