C25H29N3O3S — CID 125117891
2-[(4S)-3-(cyclohexylmethyl)-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 125117891) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 2-[(4S)-3-(cyclohexylmethyl)-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(4S)-3-(cyclohexylmethyl)-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 125117891 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[(4S)-3-(cyclohexylmethyl)-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[C@H]2C(=O)N(c3ccccc3)C(=S)N2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H29N3O3S/c1-31-21-14-12-19(13-15-21)26-23(29)16-22-24(30)28(20-10-6-3-7-11-20)25(32)27(22)17-18-8-4-2-5-9-18/h3,6-7,10-15,18,22H,2,4-5,8-9,16-17H2,1H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | WGXYFPGUZCBODR-QFIPXVFZSA-N |
| XLogP | 4.61 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|