C15H21ClN2O3S — CID 125119704
1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(4-chlorophenyl)sulfonylethanone (PubChem CID 125119704) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(4-chlorophenyl)sulfonylethanone.
| Compound Name | 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(4-chlorophenyl)sulfonylethanone |
|---|---|
| PubChem CID | 125119704 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(4-chlorophenyl)sulfonylethanone |
| SMILES | C[C@@H](N)[C@@H]1CCCN(C(=O)CS(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-11(17)12-3-2-8-18(9-12)15(19)10-22(20,21)14-6-4-13(16)5-7-14/h4-7,11-12H,2-3,8-10,17H2,1H3/t11-,12-/m1/s1 |
| InChIKey | DHNKNOYUUFOCRG-VXGBXAGGSA-N |
| XLogP | 1.70 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |