C15H20BrClN2O — CID 125147046
1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(2-bromo-4-chlorophenyl)ethanone (PubChem CID 125147046) has the molecular formula C15H20BrClN2O and a molecular weight of 359.70 g/mol. Its IUPAC name is 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(2-bromo-4-chlorophenyl)ethanone.
| Compound Name | 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(2-bromo-4-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 125147046 |
| Molecular Formula | C15H20BrClN2O |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1-[(3R)-3-[(1R)-1-aminoethyl]piperidin-1-yl]-2-(2-bromo-4-chlorophenyl)ethanone |
| SMILES | C[C@@H](N)[C@@H]1CCCN(C(=O)Cc2ccc(Cl)cc2Br)C1 |
| InChI | InChI=1S/C15H20BrClN2O/c1-10(18)12-3-2-6-19(9-12)15(20)7-11-4-5-13(17)8-14(11)16/h4-5,8,10,12H,2-3,6-7,9,18H2,1H3/t10-,12-/m1/s1 |
| InChIKey | SVJAQWWKXGQHIH-ZYHUDNBSSA-N |
| XLogP | 3.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |