C20H23N3O2 — CID 125120172
3-(2-aminophenyl)-N-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]propanamide (PubChem CID 125120172) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 125120172 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-(2-aminophenyl)-N-[(3S,5S)-5-methyl-2-oxo-1-phenylpyrrolidin-3-yl]propanamide |
| SMILES | C[C@H]1C[C@H](NC(=O)CCc2ccccc2N)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-14-13-18(20(25)23(14)16-8-3-2-4-9-16)22-19(24)12-11-15-7-5-6-10-17(15)21/h2-10,14,18H,11-13,21H2,1H3,(H,22,24)/t14-,18-/m0/s1 |
| InChIKey | BHNGDVPYXYNACI-KSSFIOAISA-N |
| XLogP | 2.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|