C23H16FNO5 — CID 125122374
(3R)-3-[3-(2-fluorophenyl)-7-hydroxy-4-oxochromen-8-yl]-3-pyridin-3-ylpropanoic acid (PubChem CID 125122374) has the molecular formula C23H16FNO5 and a molecular weight of 405.38 g/mol. Its IUPAC name is (3R)-3-[3-(2-fluorophenyl)-7-hydroxy-4-oxochromen-8-yl]-3-pyridin-3-ylpropanoic acid.
| Compound Name | (3R)-3-[3-(2-fluorophenyl)-7-hydroxy-4-oxochromen-8-yl]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 125122374 |
| Molecular Formula | C23H16FNO5 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (3R)-3-[3-(2-fluorophenyl)-7-hydroxy-4-oxochromen-8-yl]-3-pyridin-3-ylpropanoic acid |
| SMILES | O=C(O)C[C@H](c1cccnc1)c1c(O)ccc2c(=O)c(-c3ccccc3F)coc12 |
| InChI | InChI=1S/C23H16FNO5/c24-18-6-2-1-5-14(18)17-12-30-23-15(22(17)29)7-8-19(26)21(23)16(10-20(27)28)13-4-3-9-25-11-13/h1-9,11-12,16,26H,10H2,(H,27,28)/t16-/m1/s1 |
| InChIKey | ILQWTVJRMXOJPM-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |