C33H42N4O5 — CID 125123939
5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-octoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 125123939) has the molecular formula C33H42N4O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-octoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-octoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 125123939 |
| Molecular Formula | C33H42N4O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 5-[(R)-(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(4-octoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCCCCCOc1ccc([C@H](c2n(Cc3ccccc3)c(C)c(C)[n+]2[O-])C2C(=O)N(C)C(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C33H42N4O5/c1-6-7-8-9-10-14-21-42-27-19-17-26(18-20-27)28(29-31(38)34(4)33(40)35(5)32(29)39)30-36(23(2)24(3)37(30)41)22-25-15-12-11-13-16-25/h11-13,15-20,28-29H,6-10,14,21-22H2,1-5H3/t28-/m0/s1 |
| InChIKey | QCSLNSASJHEIIK-NDEPHWFRSA-N |
| XLogP | 5.32 |
| TPSA | 98.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|