C36H38O5 — CID 4921434
2-[(2,6-dioxo-4-phenylcyclohexyl)-(4-pentoxyphenyl)methyl]-5-phenylcyclohexane-1,3-dione (PubChem CID 4921434) has the molecular formula C36H38O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-[(2,6-dioxo-4-phenylcyclohexyl)-(4-pentoxyphenyl)methyl]-5-phenylcyclohexane-1,3-dione.
| Compound Name | 2-[(2,6-dioxo-4-phenylcyclohexyl)-(4-pentoxyphenyl)methyl]-5-phenylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 4921434 |
| Molecular Formula | C36H38O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 2-[(2,6-dioxo-4-phenylcyclohexyl)-(4-pentoxyphenyl)methyl]-5-phenylcyclohexane-1,3-dione |
| SMILES | CCCCCOc1ccc(C(C2C(=O)CC(c3ccccc3)CC2=O)C2C(=O)CC(c3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C36H38O5/c1-2-3-10-19-41-29-17-15-26(16-18-29)34(35-30(37)20-27(21-31(35)38)24-11-6-4-7-12-24)36-32(39)22-28(23-33(36)40)25-13-8-5-9-14-25/h4-9,11-18,27-28,34-36H,2-3,10,19-23H2,1H3 |
| InChIKey | XLXQHNZZSYQGJM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|