C24H32N2O4 — CID 90819626
1-[1,2-dinitroso-2-(4-pentoxyphenyl)ethyl]-4-pentoxybenzene (PubChem CID 90819626) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[1,2-dinitroso-2-(4-pentoxyphenyl)ethyl]-4-pentoxybenzene.
| Compound Name | 1-[1,2-dinitroso-2-(4-pentoxyphenyl)ethyl]-4-pentoxybenzene |
|---|---|
| PubChem CID | 90819626 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[1,2-dinitroso-2-(4-pentoxyphenyl)ethyl]-4-pentoxybenzene |
| SMILES | CCCCCOc1ccc(C(N=O)C(N=O)c2ccc(OCCCCC)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O4/c1-3-5-7-17-29-21-13-9-19(10-14-21)23(25-27)24(26-28)20-11-15-22(16-12-20)30-18-8-6-4-2/h9-16,23-24H,3-8,17-18H2,1-2H3 |
| InChIKey | KNFXYFQCYDGSTH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|