C17H22ClN5O — CID 125129833
1-[[(3S)-1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(1-methylpyrazol-4-yl)urea (PubChem CID 125129833) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-[[(3S)-1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(1-methylpyrazol-4-yl)urea.
| Compound Name | 1-[[(3S)-1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(1-methylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 125129833 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[[(3S)-1-(5-chloro-2-methylphenyl)pyrrolidin-3-yl]methyl]-3-(1-methylpyrazol-4-yl)urea |
| SMILES | Cc1ccc(Cl)cc1N1CC[C@@H](CNC(=O)Nc2cnn(C)c2)C1 |
| InChI | InChI=1S/C17H22ClN5O/c1-12-3-4-14(18)7-16(12)23-6-5-13(10-23)8-19-17(24)21-15-9-20-22(2)11-15/h3-4,7,9,11,13H,5-6,8,10H2,1-2H3,(H2,19,21,24)/t13-/m0/s1 |
| InChIKey | KACDZFFVSOKQPF-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |