2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid

C13H17NO3 — CID 125130227

IUPAC2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid
SMILESC[C@@H]1CO[C@@H](c2ccccc2)CN1CC(=O)O
InChIInChI=1S/C13H17NO3/c1-10-9-17-12(7-14(10)8-13(15)16)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3,(H,15,16)/t10-,12-/m1/s1
InChIKeyZDAVURGEUUEMDE-ZYHUDNBSSA-N
MW235.28 g/mol
LogP1.53
Rot. Bonds3

About 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid

2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid (PubChem CID 125130227) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid.

Molecular Properties

Compound Name2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid
PubChem CID125130227
Molecular FormulaC13H17NO3
Molecular Weight235.28 g/mol
Exact Mass235.12
IUPAC Name2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid
SMILESC[C@@H]1CO[C@@H](c2ccccc2)CN1CC(=O)O
InChIInChI=1S/C13H17NO3/c1-10-9-17-12(7-14(10)8-13(15)16)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3,(H,15,16)/t10-,12-/m1/s1
InChIKeyZDAVURGEUUEMDE-ZYHUDNBSSA-N
XLogP1.53
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.28
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid?
The IUPAC name of 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid (CID 125130227) is 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid.
What is the SMILES notation for 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid?
The canonical SMILES for 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid is C[C@@H]1CO[C@@H](c2ccccc2)CN1CC(=O)O.
What is the InChIKey of 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid?
The InChIKey is ZDAVURGEUUEMDE-ZYHUDNBSSA-N. The full InChI is InChI=1S/C13H17NO3/c1-10-9-17-12(7-14(10)8-13(15)16)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3,(H,15,16)/t10-,12-/m1/s1.
What are the key properties of 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid?
2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid has a molecular weight of 235.28 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,5R)-5-methyl-2-phenylmorpholin-4-yl]acetic acid is sourced from PubChem (CID 125130227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).