C14H18ClNO3 — CID 97094798
3-[(2S,5R)-2-(2-chlorophenyl)-5-methylmorpholin-4-yl]propanoic acid (PubChem CID 97094798) has the molecular formula C14H18ClNO3 and a molecular weight of 283.75 g/mol. Its IUPAC name is 3-[(2S,5R)-2-(2-chlorophenyl)-5-methylmorpholin-4-yl]propanoic acid.
| Compound Name | 3-[(2S,5R)-2-(2-chlorophenyl)-5-methylmorpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 97094798 |
| Molecular Formula | C14H18ClNO3 |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[(2S,5R)-2-(2-chlorophenyl)-5-methylmorpholin-4-yl]propanoic acid |
| SMILES | C[C@@H]1CO[C@@H](c2ccccc2Cl)CN1CCC(=O)O |
| InChI | InChI=1S/C14H18ClNO3/c1-10-9-19-13(8-16(10)7-6-14(17)18)11-4-2-3-5-12(11)15/h2-5,10,13H,6-9H2,1H3,(H,17,18)/t10-,13-/m1/s1 |
| InChIKey | IXNPRHFWJWTDEO-ZWNOBZJWSA-N |
| XLogP | 2.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |