About 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide
4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide (PubChem CID 125131132) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide |
| PubChem CID | 125131132 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide |
| SMILES | C[C@H]1C[C@@H](NC(=O)CNC(=O)c2ccc(C(C)(C)C)cc2)C(=O)O1 |
| InChI | InChI=1S/C18H24N2O4/c1-11-9-14(17(23)24-11)20-15(21)10-19-16(22)12-5-7-13(8-6-12)18(2,3)4/h5-8,11,14H,9-10H2,1-4H3,(H,19,22)(H,20,21)/t11-,14+/m0/s1 |
| InChIKey | VXGYNPIVYJXWIK-SMDDNHRTSA-N |
| XLogP | 1.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide?
The IUPAC name of 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide (CID 125131132) is 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide.
What is the SMILES notation for 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide?
The canonical SMILES for 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide is C[C@H]1C[C@@H](NC(=O)CNC(=O)c2ccc(C(C)(C)C)cc2)C(=O)O1.
What is the InChIKey of 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide?
The InChIKey is VXGYNPIVYJXWIK-SMDDNHRTSA-N. The full InChI is InChI=1S/C18H24N2O4/c1-11-9-14(17(23)24-11)20-15(21)10-19-16(22)12-5-7-13(8-6-12)18(2,3)4/h5-8,11,14H,9-10H2,1-4H3,(H,19,22)(H,20,21)/t11-,14+/m0/s1.
What are the key properties of 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide?
4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide has a molecular weight of 332.40 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[2-[[(3R,5S)-5-methyl-2-oxooxolan-3-yl]amino]-2-oxoethyl]benzamide is sourced from PubChem (CID 125131132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).