C16H20N4O — CID 125134433
N-methyl-1-(2-methylphenyl)-N-[(3R)-pyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 125134433) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-methyl-1-(2-methylphenyl)-N-[(3R)-pyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | N-methyl-1-(2-methylphenyl)-N-[(3R)-pyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 125134433 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-methyl-1-(2-methylphenyl)-N-[(3R)-pyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | Cc1ccccc1-n1cc(C(=O)N(C)[C@@H]2CCNC2)cn1 |
| InChI | InChI=1S/C16H20N4O/c1-12-5-3-4-6-15(12)20-11-13(9-18-20)16(21)19(2)14-7-8-17-10-14/h3-6,9,11,14,17H,7-8,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | DGHUNQVWJFLJRW-CQSZACIVSA-N |
| XLogP | 1.61 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |