C16H20N2O2 — CID 125137618
4-[[(1S,3R,4R)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]amino]benzonitrile (PubChem CID 125137618) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[[(1S,3R,4R)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]amino]benzonitrile.
| Compound Name | 4-[[(1S,3R,4R)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 125137618 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[[(1S,3R,4R)-3-ethoxy-5-oxaspiro[3.4]octan-1-yl]amino]benzonitrile |
| SMILES | CCO[C@@H]1C[C@H](Nc2ccc(C#N)cc2)[C@]12CCCO2 |
| InChI | InChI=1S/C16H20N2O2/c1-2-19-15-10-14(16(15)8-3-9-20-16)18-13-6-4-12(11-17)5-7-13/h4-7,14-15,18H,2-3,8-10H2,1H3/t14-,15+,16+/m0/s1 |
| InChIKey | FWVZINCSHVRPBG-ARFHVFGLSA-N |
| XLogP | 2.70 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |