C15H14N4O2S — CID 125138190
5-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-1-yl]-2-nitrobenzonitrile (PubChem CID 125138190) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 5-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-1-yl]-2-nitrobenzonitrile.
| Compound Name | 5-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-1-yl]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 125138190 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 5-[(2R)-2-(2-methyl-1,3-thiazol-4-yl)pyrrolidin-1-yl]-2-nitrobenzonitrile |
| SMILES | Cc1nc([C@H]2CCCN2c2ccc([N+](=O)[O-])c(C#N)c2)cs1 |
| InChI | InChI=1S/C15H14N4O2S/c1-10-17-13(9-22-10)15-3-2-6-18(15)12-4-5-14(19(20)21)11(7-12)8-16/h4-5,7,9,15H,2-3,6H2,1H3/t15-/m1/s1 |
| InChIKey | SFKHVSZBFJDLKK-OAHLLOKOSA-N |
| XLogP | 3.57 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|