C18H23ClN4O — CID 125138396
(3S)-1-(2-chlorophenyl)-3-[2-(2-ethylpyrazol-3-yl)ethyl-methylamino]pyrrolidin-2-one (PubChem CID 125138396) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is (3S)-1-(2-chlorophenyl)-3-[2-(2-ethylpyrazol-3-yl)ethyl-methylamino]pyrrolidin-2-one.
| Compound Name | (3S)-1-(2-chlorophenyl)-3-[2-(2-ethylpyrazol-3-yl)ethyl-methylamino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125138396 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (3S)-1-(2-chlorophenyl)-3-[2-(2-ethylpyrazol-3-yl)ethyl-methylamino]pyrrolidin-2-one |
| SMILES | CCn1nccc1CCN(C)[C@H]1CCN(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C18H23ClN4O/c1-3-23-14(8-11-20-23)9-12-21(2)17-10-13-22(18(17)24)16-7-5-4-6-15(16)19/h4-8,11,17H,3,9-10,12-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | XMMBPRIVFLVKRM-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |