C16H15ClN2O3 — CID 95310213
N-[(3S)-1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylfuran-3-carboxamide (PubChem CID 95310213) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is N-[(3S)-1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylfuran-3-carboxamide.
| Compound Name | N-[(3S)-1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 95310213 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[(3S)-1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylfuran-3-carboxamide |
| SMILES | CN(C(=O)c1ccoc1)[C@H]1CCN(c2ccccc2Cl)C1=O |
| InChI | InChI=1S/C16H15ClN2O3/c1-18(15(20)11-7-9-22-10-11)14-6-8-19(16(14)21)13-5-3-2-4-12(13)17/h2-5,7,9-10,14H,6,8H2,1H3/t14-/m0/s1 |
| InChIKey | KAVGJLUQIULQRY-AWEZNQCLSA-N |
| XLogP | 2.81 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |