C16H15F3N2O — CID 125140096
(3R,5R)-1-pyridin-2-yl-5-[2-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 125140096) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is (3R,5R)-1-pyridin-2-yl-5-[2-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
| Compound Name | (3R,5R)-1-pyridin-2-yl-5-[2-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 125140096 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (3R,5R)-1-pyridin-2-yl-5-[2-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1C[C@H](c2ccccc2C(F)(F)F)N(c2ccccn2)C1 |
| InChI | InChI=1S/C16H15F3N2O/c17-16(18,19)13-6-2-1-5-12(13)14-9-11(22)10-21(14)15-7-3-4-8-20-15/h1-8,11,14,22H,9-10H2/t11-,14-/m1/s1 |
| InChIKey | AWIVZNSAQORFTL-BXUZGUMPSA-N |
| XLogP | 3.41 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |