C19H27NO3S — CID 125140269
[4-(2-methoxyethoxy)cyclohexyl]-[(2R)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]methanone (PubChem CID 125140269) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)cyclohexyl]-[(2R)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]methanone.
| Compound Name | [4-(2-methoxyethoxy)cyclohexyl]-[(2R)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]methanone |
|---|---|
| PubChem CID | 125140269 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [4-(2-methoxyethoxy)cyclohexyl]-[(2R)-2-methyl-2,3-dihydro-1,4-benzothiazin-4-yl]methanone |
| SMILES | COCCOC1CCC(C(=O)N2C[C@@H](C)Sc3ccccc32)CC1 |
| InChI | InChI=1S/C19H27NO3S/c1-14-13-20(17-5-3-4-6-18(17)24-14)19(21)15-7-9-16(10-8-15)23-12-11-22-2/h3-6,14-16H,7-13H2,1-2H3/t14-,15?,16?/m1/s1 |
| InChIKey | SHSNFRCFXKARHY-QQFBHYJXSA-N |
| XLogP | 3.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|