About ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate
ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate (PubChem CID 20907182) has the molecular formula C19H20N2O3S
and a molecular weight of 356.45 g/mol. Its IUPAC name is ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate.
Molecular Properties
| Compound Name | ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate |
| PubChem CID | 20907182 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1CC(C)Sc2ccccc21 |
| InChI | InChI=1S/C19H20N2O3S/c1-3-24-18(22)14-8-4-5-9-15(14)20-19(23)21-12-13(2)25-17-11-7-6-10-16(17)21/h4-11,13H,3,12H2,1-2H3,(H,20,23) |
| InChIKey | YZJPDYCSWJODFV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate?
The IUPAC name of ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate (CID 20907182) is ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate.
What is the SMILES notation for ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate?
The canonical SMILES for ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate is CCOC(=O)c1ccccc1NC(=O)N1CC(C)Sc2ccccc21.
What is the InChIKey of ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate?
The InChIKey is YZJPDYCSWJODFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3S/c1-3-24-18(22)14-8-4-5-9-15(14)20-19(23)21-12-13(2)25-17-11-7-6-10-16(17)21/h4-11,13H,3,12H2,1-2H3,(H,20,23).
What are the key properties of ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate?
ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate has a molecular weight of 356.45 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-methyl-2,3-dihydro-1,4-benzothiazine-4-carbonyl)amino]benzoate is sourced from PubChem (CID 20907182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).