C20H29N3O2 — CID 125141016
(4aR,7aS)-N-[(1R)-1-(3-pyrrolidin-1-ylphenyl)ethyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide (PubChem CID 125141016) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (4aR,7aS)-N-[(1R)-1-(3-pyrrolidin-1-ylphenyl)ethyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide.
| Compound Name | (4aR,7aS)-N-[(1R)-1-(3-pyrrolidin-1-ylphenyl)ethyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 125141016 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (4aR,7aS)-N-[(1R)-1-(3-pyrrolidin-1-ylphenyl)ethyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCO[C@H]2CCC[C@H]21)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-15(16-6-4-7-17(14-16)22-10-2-3-11-22)21-20(24)23-12-13-25-19-9-5-8-18(19)23/h4,6-7,14-15,18-19H,2-3,5,8-13H2,1H3,(H,21,24)/t15-,18-,19+/m1/s1 |
| InChIKey | OPUCUDWKFBFBEO-LZQZEXGQSA-N |
| XLogP | 3.31 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |