C18H24N2O3 — CID 125141057
1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[[(2R,3S)-2-prop-1-en-2-yloxolan-3-yl]methyl]urea (PubChem CID 125141057) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[[(2R,3S)-2-prop-1-en-2-yloxolan-3-yl]methyl]urea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[[(2R,3S)-2-prop-1-en-2-yloxolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 125141057 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[[(2R,3S)-2-prop-1-en-2-yloxolan-3-yl]methyl]urea |
| SMILES | C=C(C)[C@@H]1OCC[C@H]1CNC(=O)N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C18H24N2O3/c1-12(2)17-13(7-9-23-17)11-19-18(21)20-15-8-10-22-16-6-4-3-5-14(15)16/h3-6,13,15,17H,1,7-11H2,2H3,(H2,19,20,21)/t13-,15-,17-/m0/s1 |
| InChIKey | JZUHREGFWDHAIE-QRTARXTBSA-N |
| XLogP | 2.79 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|