C12H19ClN6O2 — CID 125141490
2-[[(2S)-4-(6-amino-5-chloropyrimidin-4-yl)morpholin-2-yl]methyl-methylamino]acetamide (PubChem CID 125141490) has the molecular formula C12H19ClN6O2 and a molecular weight of 314.78 g/mol. Its IUPAC name is 2-[[(2S)-4-(6-amino-5-chloropyrimidin-4-yl)morpholin-2-yl]methyl-methylamino]acetamide.
| Compound Name | 2-[[(2S)-4-(6-amino-5-chloropyrimidin-4-yl)morpholin-2-yl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 125141490 |
| Molecular Formula | C12H19ClN6O2 |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-[[(2S)-4-(6-amino-5-chloropyrimidin-4-yl)morpholin-2-yl]methyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)C[C@H]1CN(c2ncnc(N)c2Cl)CCO1 |
| InChI | InChI=1S/C12H19ClN6O2/c1-18(6-9(14)20)4-8-5-19(2-3-21-8)12-10(13)11(15)16-7-17-12/h7-8H,2-6H2,1H3,(H2,14,20)(H2,15,16,17)/t8-/m0/s1 |
| InChIKey | YCAWIPKYNVVYDO-QMMMGPOBSA-N |
| XLogP | -0.67 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |