C12H14F3N3O3S — CID 125142953
(3R)-3-(methylsulfamoylamino)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 125142953) has the molecular formula C12H14F3N3O3S and a molecular weight of 337.32 g/mol. Its IUPAC name is (3R)-3-(methylsulfamoylamino)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | (3R)-3-(methylsulfamoylamino)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125142953 |
| Molecular Formula | C12H14F3N3O3S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (3R)-3-(methylsulfamoylamino)-1-[2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | CNS(=O)(=O)N[C@@H]1CCN(c2ccccc2C(F)(F)F)C1=O |
| InChI | InChI=1S/C12H14F3N3O3S/c1-16-22(20,21)17-9-6-7-18(11(9)19)10-5-3-2-4-8(10)12(13,14)15/h2-5,9,16-17H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | PVYCFCTWKXSDHW-SECBINFHSA-N |
| XLogP | 0.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |